C21H29N3O2S — CID 11916493
(2S)-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide (PubChem CID 11916493) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is (2S)-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 11916493 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (2S)-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(-c2nnc(S[C@@H](C)C(=O)N[C@H]3CCC[C@H](C)[C@@H]3C)o2)cc1C |
| InChI | InChI=1S/C21H29N3O2S/c1-12-9-10-17(11-14(12)3)20-23-24-21(26-20)27-16(5)19(25)22-18-8-6-7-13(2)15(18)4/h9-11,13,15-16,18H,6-8H2,1-5H3,(H,22,25)/t13-,15-,16-,18-/m0/s1 |
| InChIKey | LGYQJQOCLHKFET-MBGYTDRXSA-N |
| XLogP | 4.77 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |