C23H34N4O2S — CID 11945146
(2R)-2-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11945146) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is (2R)-2-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11945146 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (2R)-2-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | CCN(CC)c1ccc(-c2nnc(S[C@H](C)C(=O)N[C@H]3CCC[C@H](C)[C@@H]3C)o2)cc1 |
| InChI | InChI=1S/C23H34N4O2S/c1-6-27(7-2)19-13-11-18(12-14-19)22-25-26-23(29-22)30-17(5)21(28)24-20-10-8-9-15(3)16(20)4/h11-17,20H,6-10H2,1-5H3,(H,24,28)/t15-,16-,17+,20-/m0/s1 |
| InChIKey | FSIBKOHHWYESGA-LJCCNALRSA-N |
| XLogP | 5.00 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |