C18H30N4OS — CID 11932492
(2R)-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11932492) has the molecular formula C18H30N4OS and a molecular weight of 350.53 g/mol. Its IUPAC name is (2R)-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11932492 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2R)-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | CCn1c(S[C@H](C)C(=O)N[C@H]2CCC[C@H](C)[C@@H]2C)nnc1C1CC1 |
| InChI | InChI=1S/C18H30N4OS/c1-5-22-16(14-9-10-14)20-21-18(22)24-13(4)17(23)19-15-8-6-7-11(2)12(15)3/h11-15H,5-10H2,1-4H3,(H,19,23)/t11-,12-,13+,15-/m0/s1 |
| InChIKey | NHBXSMYTRJLTDG-XPCVCDNBSA-N |
| XLogP | 3.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |