C17H24N4OS — CID 11918299
(2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide (PubChem CID 11918299) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide.
| Compound Name | (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 11918299 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)[C@@H](C)Sc1nnc2ccccn12 |
| InChI | InChI=1S/C17H24N4OS/c1-11-7-6-8-14(12(11)2)18-16(22)13(3)23-17-20-19-15-9-4-5-10-21(15)17/h4-5,9-14H,6-8H2,1-3H3,(H,18,22)/t11-,12+,13+,14+/m0/s1 |
| InChIKey | QDFDPGLSQWKLTG-REWJHTLYSA-N |
| XLogP | 3.15 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |