C16H22N4OS — CID 11908002
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide (PubChem CID 11908002) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 11908002 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)CSc1nnc2ccccn12 |
| InChI | InChI=1S/C16H22N4OS/c1-11-6-5-7-13(12(11)2)17-15(21)10-22-16-19-18-14-8-3-4-9-20(14)16/h3-4,8-9,11-13H,5-7,10H2,1-2H3,(H,17,21)/t11-,12-,13-/m1/s1 |
| InChIKey | JLOHXJVFQIFKPW-JHJVBQTASA-N |
| XLogP | 2.76 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |