C17H24N6OS — CID 11923208
2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11923208) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11923208 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-[(4-amino-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)CSc1nnc(-c2cccnc2)n1N |
| InChI | InChI=1S/C17H24N6OS/c1-11-5-3-7-14(12(11)2)20-15(24)10-25-17-22-21-16(23(17)18)13-6-4-8-19-9-13/h4,6,8-9,11-12,14H,3,5,7,10,18H2,1-2H3,(H,20,24)/t11-,12+,14+/m0/s1 |
| InChIKey | JTVXAKBJXWAESZ-OUCADQQQSA-N |
| XLogP | 2.09 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |