C20H27N5OS — CID 11934792
2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11934792) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11934792 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)CSc1nnc(-c2cccnc2)n1C1CC1 |
| InChI | InChI=1S/C20H27N5OS/c1-13-5-3-7-17(14(13)2)22-18(26)12-27-20-24-23-19(25(20)16-8-9-16)15-6-4-10-21-11-15/h4,6,10-11,13-14,16-17H,3,5,7-9,12H2,1-2H3,(H,22,26)/t13-,14+,17+/m0/s1 |
| InChIKey | DXZQNCMAAZHTKB-JJRVBVJISA-N |
| XLogP | 3.71 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |