C20H28N4OS2 — CID 11934518
(2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11934518) has the molecular formula C20H28N4OS2 and a molecular weight of 404.61 g/mol. Its IUPAC name is (2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11934518 |
| Molecular Formula | C20H28N4OS2 |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2nnc(-c3cccs3)n2C2CC2)CCC[C@@H]1C |
| InChI | InChI=1S/C20H28N4OS2/c1-12-6-4-7-16(13(12)2)21-19(25)14(3)27-20-23-22-18(17-8-5-11-26-17)24(20)15-9-10-15/h5,8,11-16H,4,6-7,9-10H2,1-3H3,(H,21,25)/t12-,13+,14+,16-/m0/s1 |
| InChIKey | AXXGCSXCEPTUPT-NHIYQJMISA-N |
| XLogP | 4.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |