C19H26N4OS2 — CID 11920527
(2R)-2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11920527) has the molecular formula C19H26N4OS2 and a molecular weight of 390.58 g/mol. Its IUPAC name is (2R)-2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11920527 |
| Molecular Formula | C19H26N4OS2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (2R)-2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)[C@@H](C)Sc1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C19H26N4OS2/c1-12-8-7-11-16(13(12)2)21-17(24)14(3)25-19-23-22-18(26-19)20-15-9-5-4-6-10-15/h4-6,9-10,12-14,16H,7-8,11H2,1-3H3,(H,20,22)(H,21,24)/t12-,13-,14-,16-/m1/s1 |
| InChIKey | KDPUIENQELCSMX-IXYNUQLISA-N |
| XLogP | 4.70 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |