C20H28N4OS2 — CID 8024951
(2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 8024951) has the molecular formula C20H28N4OS2 and a molecular weight of 404.61 g/mol. Its IUPAC name is (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 8024951 |
| Molecular Formula | C20H28N4OS2 |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (2R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | Cc1cccc(Nc2nnc(S[C@H](C)C(=O)N[C@@H]3CCC[C@H](C)[C@H]3C)s2)c1 |
| InChI | InChI=1S/C20H28N4OS2/c1-12-7-5-9-16(11-12)21-19-23-24-20(27-19)26-15(4)18(25)22-17-10-6-8-13(2)14(17)3/h5,7,9,11,13-15,17H,6,8,10H2,1-4H3,(H,21,23)(H,22,25)/t13-,14+,15+,17+/m0/s1 |
| InChIKey | CDTDYTIROYTOCX-KLZNWCGWSA-N |
| XLogP | 5.01 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |