C22H16N4O4S2 — CID 40832647
N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 40832647) has the molecular formula C22H16N4O4S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 40832647 |
| Molecular Formula | C22H16N4O4S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc3c(c2)OCO3)s1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H16N4O4S2/c27-19(23-16-7-3-5-13-4-1-2-6-15(13)16)11-31-22-26-25-21(32-22)24-20(28)14-8-9-17-18(10-14)30-12-29-17/h1-10H,11-12H2,(H,23,27)(H,24,25,28) |
| InChIKey | ZXCUWHDMYUZCCR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|