C22H15F3N4O2S2 — CID 44956875
N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 44956875) has the molecular formula C22H15F3N4O2S2 and a molecular weight of 488.52 g/mol. Its IUPAC name is N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44956875 |
| Molecular Formula | C22H15F3N4O2S2 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | N-[5-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccccc2C(F)(F)F)s1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H15F3N4O2S2/c23-22(24,25)16-10-4-3-9-15(16)19(31)27-20-28-29-21(33-20)32-12-18(30)26-17-11-5-7-13-6-1-2-8-14(13)17/h1-11H,12H2,(H,26,30)(H,27,28,31) |
| InChIKey | XECJWBGAVROLCC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|