C20H17F3N4O2S2 — CID 4638620
N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 4638620) has the molecular formula C20H17F3N4O2S2 and a molecular weight of 466.51 g/mol. Its IUPAC name is N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4638620 |
| Molecular Formula | C20H17F3N4O2S2 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C)c(NC(=O)CSc2nnc(NC(=O)c3ccccc3C(F)(F)F)s2)c1 |
| InChI | InChI=1S/C20H17F3N4O2S2/c1-11-7-8-12(2)15(9-11)24-16(28)10-30-19-27-26-18(31-19)25-17(29)13-5-3-4-6-14(13)20(21,22)23/h3-9H,10H2,1-2H3,(H,24,28)(H,25,26,29) |
| InChIKey | SZQAIJXJNZMLFG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|