C19H12F6N4O3S2 — CID 44956878
N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 44956878) has the molecular formula C19H12F6N4O3S2 and a molecular weight of 522.45 g/mol. Its IUPAC name is N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44956878 |
| Molecular Formula | C19H12F6N4O3S2 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccccc2C(F)(F)F)s1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12F6N4O3S2/c20-18(21,22)13-4-2-1-3-12(13)15(31)27-16-28-29-17(34-16)33-9-14(30)26-10-5-7-11(8-6-10)32-19(23,24)25/h1-8H,9H2,(H,26,30)(H,27,28,31) |
| InChIKey | RTCPBBNCVJDMMV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|