C18H12F3N5O5S2 — CID 40833370
4-nitro-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 40833370) has the molecular formula C18H12F3N5O5S2 and a molecular weight of 499.45 g/mol. Its IUPAC name is 4-nitro-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-nitro-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 40833370 |
| Molecular Formula | C18H12F3N5O5S2 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 4-nitro-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc([N+](=O)[O-])cc2)s1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F3N5O5S2/c19-18(20,21)31-13-7-3-11(4-8-13)22-14(27)9-32-17-25-24-16(33-17)23-15(28)10-1-5-12(6-2-10)26(29)30/h1-8H,9H2,(H,22,27)(H,23,24,28) |
| InChIKey | YCCXRGOHVGORRR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|