C22H22F3N5O5S3 — CID 44956569
4-(diethylsulfamoyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 44956569) has the molecular formula C22H22F3N5O5S3 and a molecular weight of 589.64 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44956569 |
| Molecular Formula | C22H22F3N5O5S3 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.07 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nnc(SCC(=O)Nc3ccc(OC(F)(F)F)cc3)s2)cc1 |
| InChI | InChI=1S/C22H22F3N5O5S3/c1-3-30(4-2)38(33,34)17-11-5-14(6-12-17)19(32)27-20-28-29-21(37-20)36-13-18(31)26-15-7-9-16(10-8-15)35-22(23,24)25/h5-12H,3-4,13H2,1-2H3,(H,26,31)(H,27,28,32) |
| InChIKey | DVILUPUJPHAHPL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|