C17H22N4O5S3 — CID 23820424
ethyl 2-[[5-[[4-(diethylsulfamoyl)benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 23820424) has the molecular formula C17H22N4O5S3 and a molecular weight of 458.59 g/mol. Its IUPAC name is ethyl 2-[[5-[[4-(diethylsulfamoyl)benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[4-(diethylsulfamoyl)benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 23820424 |
| Molecular Formula | C17H22N4O5S3 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | ethyl 2-[[5-[[4-(diethylsulfamoyl)benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)s1 |
| InChI | InChI=1S/C17H22N4O5S3/c1-4-21(5-2)29(24,25)13-9-7-12(8-10-13)15(23)18-16-19-20-17(28-16)27-11-14(22)26-6-3/h7-10H,4-6,11H2,1-3H3,(H,18,19,23) |
| InChIKey | FYNSVULVVKYUCU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|