C17H17N5O3S2 — CID 55386656
ethyl 2-[[5-[(2,3-dimethylquinoxaline-6-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 55386656) has the molecular formula C17H17N5O3S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is ethyl 2-[[5-[(2,3-dimethylquinoxaline-6-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[(2,3-dimethylquinoxaline-6-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55386656 |
| Molecular Formula | C17H17N5O3S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | ethyl 2-[[5-[(2,3-dimethylquinoxaline-6-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2ccc3nc(C)c(C)nc3c2)s1 |
| InChI | InChI=1S/C17H17N5O3S2/c1-4-25-14(23)8-26-17-22-21-16(27-17)20-15(24)11-5-6-12-13(7-11)19-10(3)9(2)18-12/h5-7H,4,8H2,1-3H3,(H,20,21,24) |
| InChIKey | ZMHYACBSMUFRON-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|