C18H20N4O5S2 — CID 30748005
ethyl 2-[[5-[[3-[[(2R)-oxolane-2-carbonyl]amino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 30748005) has the molecular formula C18H20N4O5S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is ethyl 2-[[5-[[3-[[(2R)-oxolane-2-carbonyl]amino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[3-[[(2R)-oxolane-2-carbonyl]amino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 30748005 |
| Molecular Formula | C18H20N4O5S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | ethyl 2-[[5-[[3-[[(2R)-oxolane-2-carbonyl]amino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)c2cccc(NC(=O)[C@H]3CCCO3)c2)s1 |
| InChI | InChI=1S/C18H20N4O5S2/c1-2-26-14(23)10-28-18-22-21-17(29-18)20-15(24)11-5-3-6-12(9-11)19-16(25)13-7-4-8-27-13/h3,5-6,9,13H,2,4,7-8,10H2,1H3,(H,19,25)(H,20,21,24)/t13-/m1/s1 |
| InChIKey | MEZFCZGZGJJCQQ-CYBMUJFWSA-N |
| XLogP | 2.56 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|