C15H15N3O3S2 — CID 52988728
N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)oxolane-2-carboxamide (PubChem CID 52988728) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)oxolane-2-carboxamide.
| Compound Name | N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 52988728 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)oxolane-2-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)C2CCCO2)s1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O3S2/c19-11(10-5-2-1-3-6-10)9-22-15-18-17-14(23-15)16-13(20)12-7-4-8-21-12/h1-3,5-6,12H,4,7-9H2,(H,16,17,20) |
| InChIKey | XXMGVFLRKUSWND-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|