C17H18N4O5S2 — CID 23796964
2-[[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid (PubChem CID 23796964) has the molecular formula C17H18N4O5S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 23796964 |
| Molecular Formula | C17H18N4O5S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2-[[5-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccccc2C(=O)O)s1)NCC1CCCO1 |
| InChI | InChI=1S/C17H18N4O5S2/c22-13(18-8-10-4-3-7-26-10)9-27-17-21-20-16(28-17)19-14(23)11-5-1-2-6-12(11)15(24)25/h1-2,5-6,10H,3-4,7-9H2,(H,18,22)(H,24,25)(H,19,20,23) |
| InChIKey | RRVKCRGCQSNNSG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|