C17H13N3O2S2 — CID 4276006
N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 4276006) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4276006 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccccc2)s1)c1ccccc1 |
| InChI | InChI=1S/C17H13N3O2S2/c21-14(12-7-3-1-4-8-12)11-23-17-20-19-16(24-17)18-15(22)13-9-5-2-6-10-13/h1-10H,11H2,(H,18,19,22) |
| InChIKey | KGCQSTSOGPZYBX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|