C21H16N4O3S2 — CID 46299902
3-methyl-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 46299902) has the molecular formula C21H16N4O3S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-methyl-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-methyl-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46299902 |
| Molecular Formula | C21H16N4O3S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 3-methyl-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(-c2ccccc2)c1C(=O)Nc1nnc(SCC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C21H16N4O3S2/c1-13-17(18(28-25-13)15-10-6-3-7-11-15)19(27)22-20-23-24-21(30-20)29-12-16(26)14-8-4-2-5-9-14/h2-11H,12H2,1H3,(H,22,23,27) |
| InChIKey | QRZRCFUIQTVYHD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|