C17H12N4O4S2 — CID 4254017
2-nitro-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 4254017) has the molecular formula C17H12N4O4S2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-nitro-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-nitro-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4254017 |
| Molecular Formula | C17H12N4O4S2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-nitro-N-(5-phenacylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccccc2[N+](=O)[O-])s1)c1ccccc1 |
| InChI | InChI=1S/C17H12N4O4S2/c22-14(11-6-2-1-3-7-11)10-26-17-20-19-16(27-17)18-15(23)12-8-4-5-9-13(12)21(24)25/h1-9H,10H2,(H,18,19,23) |
| InChIKey | MOPDJWNADUEJMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|