C17H13N5O4S2 — CID 2296388
N-[5-(2-anilino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide (PubChem CID 2296388) has the molecular formula C17H13N5O4S2 and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[5-(2-anilino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide.
| Compound Name | N-[5-(2-anilino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2296388 |
| Molecular Formula | C17H13N5O4S2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | N-[5-(2-anilino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc([N+](=O)[O-])cc2)s1)Nc1ccccc1 |
| InChI | InChI=1S/C17H13N5O4S2/c23-14(18-12-4-2-1-3-5-12)10-27-17-21-20-16(28-17)19-15(24)11-6-8-13(9-7-11)22(25)26/h1-9H,10H2,(H,18,23)(H,19,20,24) |
| InChIKey | NAPVTVXQVUJCMP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|