C19H17N5O4S3 — CID 40833710
2-benzylsulfanyl-N-[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 40833710) has the molecular formula C19H17N5O4S3 and a molecular weight of 475.58 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 40833710 |
| Molecular Formula | C19H17N5O4S3 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 2-benzylsulfanyl-N-[5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(NC(=O)CSCc2ccccc2)s1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17N5O4S3/c25-16(11-29-10-13-4-2-1-3-5-13)21-18-22-23-19(31-18)30-12-17(26)20-14-6-8-15(9-7-14)24(27)28/h1-9H,10-12H2,(H,20,26)(H,21,22,25) |
| InChIKey | UDKRJMCRUKELLA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|