C16H13N5O3S2 — CID 2121761
2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 2121761) has the molecular formula C16H13N5O3S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2121761 |
| Molecular Formula | C16H13N5O3S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nnc(Nc2ccccc2)s1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N5O3S2/c22-14(17-12-7-4-8-13(9-12)21(23)24)10-25-16-20-19-15(26-16)18-11-5-2-1-3-6-11/h1-9H,10H2,(H,17,22)(H,18,19) |
| InChIKey | AZBKOQHTNMTJBM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|