C11H10N4O3S3 — CID 2668654
2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 2668654) has the molecular formula C11H10N4O3S3 and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2668654 |
| Molecular Formula | C11H10N4O3S3 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | CSc1nnc(SCC(=O)Nc2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C11H10N4O3S3/c1-19-10-13-14-11(21-10)20-6-9(16)12-7-3-2-4-8(5-7)15(17)18/h2-5H,6H2,1H3,(H,12,16) |
| InChIKey | HTOYXCLJENDOKQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|