C13H13N5O4S3 — CID 29351963
N'-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 29351963) has the molecular formula C13H13N5O4S3 and a molecular weight of 399.48 g/mol. Its IUPAC name is N'-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 29351963 |
| Molecular Formula | C13H13N5O4S3 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | N'-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | CCSc1nnc(SCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C13H13N5O4S3/c1-2-23-12-16-17-13(25-12)24-7-10(19)14-15-11(20)8-4-3-5-9(6-8)18(21)22/h3-6H,2,7H2,1H3,(H,14,19)(H,15,20) |
| InChIKey | DVPQZZDBDBNUTC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|