C14H17N3O4S — CID 8763621
N'-(2-cyclopentylsulfanylacetyl)-3-nitrobenzohydrazide (PubChem CID 8763621) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is N'-(2-cyclopentylsulfanylacetyl)-3-nitrobenzohydrazide.
| Compound Name | N'-(2-cyclopentylsulfanylacetyl)-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 8763621 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N'-(2-cyclopentylsulfanylacetyl)-3-nitrobenzohydrazide |
| SMILES | O=C(CSC1CCCC1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17N3O4S/c18-13(9-22-12-6-1-2-7-12)15-16-14(19)10-4-3-5-11(8-10)17(20)21/h3-5,8,12H,1-2,6-7,9H2,(H,15,18)(H,16,19) |
| InChIKey | IBKXPAPGSXYREK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|