C15H18N4O5 — CID 9218965
3-nitro-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide (PubChem CID 9218965) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 3-nitro-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide.
| Compound Name | 3-nitro-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9218965 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-nitro-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide |
| SMILES | O=C(CN1CCCCCC1=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N4O5/c20-13(10-18-8-3-1-2-7-14(18)21)16-17-15(22)11-5-4-6-12(9-11)19(23)24/h4-6,9H,1-3,7-8,10H2,(H,16,20)(H,17,22) |
| InChIKey | PQRNHDGOLXEGFF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|