C19H25N3O3 — CID 9185791
N'-[2-(2-oxoazepan-1-yl)acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide (PubChem CID 9185791) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N'-[2-(2-oxoazepan-1-yl)acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide.
| Compound Name | N'-[2-(2-oxoazepan-1-yl)acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 9185791 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N'-[2-(2-oxoazepan-1-yl)acetyl]-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide |
| SMILES | O=C(CN1CCCCCC1=O)NNC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H25N3O3/c23-17(13-22-11-5-1-2-8-18(22)24)20-21-19(25)16-10-9-14-6-3-4-7-15(14)12-16/h9-10,12H,1-8,11,13H2,(H,20,23)(H,21,25) |
| InChIKey | HIMDTPGNRWODIF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|