C17H22FN3O3 — CID 55738531
2-(4-fluorophenyl)-N'-[2-(2-oxoazocan-1-yl)acetyl]acetohydrazide (PubChem CID 55738531) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N'-[2-(2-oxoazocan-1-yl)acetyl]acetohydrazide.
| Compound Name | 2-(4-fluorophenyl)-N'-[2-(2-oxoazocan-1-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55738531 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-(4-fluorophenyl)-N'-[2-(2-oxoazocan-1-yl)acetyl]acetohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)CN1CCCCCCC1=O |
| InChI | InChI=1S/C17H22FN3O3/c18-14-8-6-13(7-9-14)11-15(22)19-20-16(23)12-21-10-4-2-1-3-5-17(21)24/h6-9H,1-5,10-12H2,(H,19,22)(H,20,23) |
| InChIKey | VHFPVYMRXNSYQF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|