C17H24N4O2S — CID 8677167
1-[[2-(2-oxoazepan-1-yl)acetyl]amino]-3-(2-phenylethyl)thiourea (PubChem CID 8677167) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[[2-(2-oxoazepan-1-yl)acetyl]amino]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[[2-(2-oxoazepan-1-yl)acetyl]amino]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 8677167 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[[2-(2-oxoazepan-1-yl)acetyl]amino]-3-(2-phenylethyl)thiourea |
| SMILES | O=C(CN1CCCCCC1=O)NNC(=S)NCCc1ccccc1 |
| InChI | InChI=1S/C17H24N4O2S/c22-15(13-21-12-6-2-5-9-16(21)23)19-20-17(24)18-11-10-14-7-3-1-4-8-14/h1,3-4,7-8H,2,5-6,9-13H2,(H,19,22)(H2,18,20,24) |
| InChIKey | KSLAEHNOUAFHFX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|