C16H22N4O2S — CID 8654421
1-(2-methylphenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea (PubChem CID 8654421) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8654421 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(2-methylphenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea |
| SMILES | Cc1ccccc1NC(=S)NNC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C16H22N4O2S/c1-12-7-4-5-8-13(12)17-16(23)19-18-14(21)11-20-10-6-2-3-9-15(20)22/h4-5,7-8H,2-3,6,9-11H2,1H3,(H,18,21)(H2,17,19,23) |
| InChIKey | MKJWOHQNAXJCHV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|