C17H24N4O3S — CID 8677198
1-[(4-methoxyphenyl)methyl]-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea (PubChem CID 8677198) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8677198 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)CN2CCCCCC2=O)cc1 |
| InChI | InChI=1S/C17H24N4O3S/c1-24-14-8-6-13(7-9-14)11-18-17(25)20-19-15(22)12-21-10-4-2-3-5-16(21)23/h6-9H,2-5,10-12H2,1H3,(H,19,22)(H2,18,20,25) |
| InChIKey | PRUFBBMBCNLITC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|