C17H23N3O4 — CID 8623673
4-(methoxymethyl)-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide (PubChem CID 8623673) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-(methoxymethyl)-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide.
| Compound Name | 4-(methoxymethyl)-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8623673 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-(methoxymethyl)-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide |
| SMILES | COCc1ccc(C(=O)NNC(=O)CN2CCCCCC2=O)cc1 |
| InChI | InChI=1S/C17H23N3O4/c1-24-12-13-6-8-14(9-7-13)17(23)19-18-15(21)11-20-10-4-2-3-5-16(20)22/h6-9H,2-5,10-12H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | PSXXFBCTZSARGS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|