C17H20ClN3O5 — CID 7727549
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727549) has the molecular formula C17H20ClN3O5 and a molecular weight of 381.82 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727549 |
| Molecular Formula | C17H20ClN3O5 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | O=C(COC(=O)CN1CCCCCC1=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClN3O5/c18-13-7-5-12(6-8-13)17(25)20-19-14(22)11-26-16(24)10-21-9-3-1-2-4-15(21)23/h5-8H,1-4,9-11H2,(H,19,22)(H,20,25) |
| InChIKey | UUPFFOXITBHYNG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|