C17H21ClN2O5 — CID 7728030
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7728030) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7728030 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C17H21ClN2O5/c1-24-14-7-6-12(18)9-13(14)19-15(21)11-25-17(23)10-20-8-4-2-3-5-16(20)22/h6-7,9H,2-5,8,10-11H2,1H3,(H,19,21) |
| InChIKey | DSGFEMSEUGGMIC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |