C16H19ClN2O4 — CID 7727947
[2-(3-chloroanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727947) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727947 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | O=C(COC(=O)CN1CCCCCC1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H19ClN2O4/c17-12-5-4-6-13(9-12)18-14(20)11-23-16(22)10-19-8-3-1-2-7-15(19)21/h4-6,9H,1-3,7-8,10-11H2,(H,18,20) |
| InChIKey | GOOBNLDVJYITLP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |