C19H25N3O5 — CID 8560767
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-oxopyrrolidin-1-yl)acetate (PubChem CID 8560767) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-oxopyrrolidin-1-yl)acetate.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-oxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 8560767 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(2-oxopyrrolidin-1-yl)acetate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COC(=O)CN2CCCC2=O)c1 |
| InChI | InChI=1S/C19H25N3O5/c1-3-21(4-2)19(26)14-7-5-8-15(11-14)20-16(23)13-27-18(25)12-22-10-6-9-17(22)24/h5,7-8,11H,3-4,6,9-10,12-13H2,1-2H3,(H,20,23) |
| InChIKey | NHXFIJKKUFARJS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |