C20H28N2O4 — CID 7727908
[2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727908) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727908 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C20H28N2O4/c1-3-15-9-8-10-16(4-2)20(15)21-17(23)14-26-19(25)13-22-12-7-5-6-11-18(22)24/h8-10H,3-7,11-14H2,1-2H3,(H,21,23) |
| InChIKey | XUPBWBFHPKOCMI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |