C18H24N2O6 — CID 7728004
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7728004) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7728004 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)CN2CCCCCC2=O)cc1OC |
| InChI | InChI=1S/C18H24N2O6/c1-24-14-8-7-13(10-15(14)25-2)19-16(21)12-26-18(23)11-20-9-5-3-4-6-17(20)22/h7-8,10H,3-6,9,11-12H2,1-2H3,(H,19,21) |
| InChIKey | OKNMLMCFCCJWGW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |