C15H19N3O5S — CID 7727491
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727491) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727491 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C15H19N3O5S/c16-14(22)10-5-7-24-15(10)17-11(19)9-23-13(21)8-18-6-3-1-2-4-12(18)20/h5,7H,1-4,6,8-9H2,(H2,16,22)(H,17,19) |
| InChIKey | CNVAUMACIJKEMW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |