C21H29N3O4 — CID 7727873
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727873) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727873 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | O=C(COC(=O)CN1CCCCCC1=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N3O4/c25-19(16-28-21(27)15-24-14-4-1-3-7-20(24)26)22-17-8-10-18(11-9-17)23-12-5-2-6-13-23/h8-11H,1-7,12-16H2,(H,22,25) |
| InChIKey | NSHNFMFKLHQPER-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|