C21H24N2O3 — CID 26747020
[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 3-phenylpropanoate (PubChem CID 26747020) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 3-phenylpropanoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 26747020 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 3-phenylpropanoate |
| SMILES | O=C(COC(=O)CCc1ccccc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c24-20(16-26-21(25)13-8-17-6-2-1-3-7-17)22-18-9-11-19(12-10-18)23-14-4-5-15-23/h1-3,6-7,9-12H,4-5,8,13-16H2,(H,22,24) |
| InChIKey | ZBESJUVPWNGGJZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|