C22H25N3O4 — CID 7780766
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-benzamidoacetate (PubChem CID 7780766) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-benzamidoacetate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 7780766 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-benzamidoacetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H25N3O4/c26-20(16-29-21(27)15-23-22(28)17-7-3-1-4-8-17)24-18-9-11-19(12-10-18)25-13-5-2-6-14-25/h1,3-4,7-12H,2,5-6,13-16H2,(H,23,28)(H,24,26) |
| InChIKey | VBKLQMBERUPMSC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|