C25H30N4O4 — CID 55426324
[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate (PubChem CID 55426324) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55426324 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CCCN(C(=O)Nc2ccccc2)C1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C25H30N4O4/c30-23(26-21-10-12-22(13-11-21)28-14-4-5-15-28)18-33-24(31)19-7-6-16-29(17-19)25(32)27-20-8-2-1-3-9-20/h1-3,8-13,19H,4-7,14-18H2,(H,26,30)(H,27,32) |
| InChIKey | YUNKAPKFNGZOMN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|