C21H21ClN4O6 — CID 55426103
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate (PubChem CID 55426103) has the molecular formula C21H21ClN4O6 and a molecular weight of 460.87 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55426103 |
| Molecular Formula | C21H21ClN4O6 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CCCN(C(=O)Nc2ccccc2)C1)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21ClN4O6/c22-15-8-9-17(18(11-15)26(30)31)24-19(27)13-32-20(28)14-5-4-10-25(12-14)21(29)23-16-6-2-1-3-7-16/h1-3,6-9,11,14H,4-5,10,12-13H2,(H,23,29)(H,24,27) |
| InChIKey | XEEJRBORALTMRN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|