C13H14ClN3O3S2 — CID 7607535
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7607535) has the molecular formula C13H14ClN3O3S2 and a molecular weight of 359.86 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7607535 |
| Molecular Formula | C13H14ClN3O3S2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14ClN3O3S2/c14-9-3-4-10(11(7-9)17(19)20)15-12(18)8-22-13(21)16-5-1-2-6-16/h3-4,7H,1-2,5-6,8H2,(H,15,18) |
| InChIKey | AAKGUYAMSFSHHW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|